C11H10FN5O2 — CID 5367960
2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 5367960) has the molecular formula C11H10FN5O2 and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5367960 |
| Molecular Formula | C11H10FN5O2 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | Nc1nonc1CC(=O)N/N=C\c1ccccc1F |
| InChI | InChI=1S/C11H10FN5O2/c12-8-4-2-1-3-7(8)6-14-15-10(18)5-9-11(13)17-19-16-9/h1-4,6H,5H2,(H2,13,17)(H,15,18)/b14-6- |
| InChIKey | BVKBGQWLJSZLGO-NSIKDUERSA-N |
| XLogP | 0.48 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|