C14H17N5O2 — CID 6166039
2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]acetamide (PubChem CID 6166039) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6166039 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
| SMILES | CC(C)c1ccc(/C=N\NC(=O)Cc2nonc2N)cc1 |
| InChI | InChI=1S/C14H17N5O2/c1-9(2)11-5-3-10(4-6-11)8-16-17-13(20)7-12-14(15)19-21-18-12/h3-6,8-9H,7H2,1-2H3,(H2,15,19)(H,17,20)/b16-8- |
| InChIKey | LXEHABWDHSVNLQ-PXNMLYILSA-N |
| XLogP | 1.47 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|