About 3-[(E)-hex-1-enyl]phenol
3-[(E)-hex-1-enyl]phenol (PubChem CID 121007177) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-[(E)-hex-1-enyl]phenol.
Molecular Properties
| Compound Name | 3-[(E)-hex-1-enyl]phenol |
| PubChem CID | 121007177 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-[(E)-hex-1-enyl]phenol |
| SMILES | CCCC/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C12H16O/c1-2-3-4-5-7-11-8-6-9-12(13)10-11/h5-10,13H,2-4H2,1H3/b7-5+ |
| InChIKey | GSAMDJOBZBHVGY-FNORWQNLSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-hex-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-hex-1-enyl]phenol?
The IUPAC name of 3-[(E)-hex-1-enyl]phenol (CID 121007177) is 3-[(E)-hex-1-enyl]phenol.
What is the SMILES notation for 3-[(E)-hex-1-enyl]phenol?
The canonical SMILES for 3-[(E)-hex-1-enyl]phenol is CCCC/C=C/c1cccc(O)c1.
What is the InChIKey of 3-[(E)-hex-1-enyl]phenol?
The InChIKey is GSAMDJOBZBHVGY-FNORWQNLSA-N. The full InChI is InChI=1S/C12H16O/c1-2-3-4-5-7-11-8-6-9-12(13)10-11/h5-10,13H,2-4H2,1H3/b7-5+.
What are the key properties of 3-[(E)-hex-1-enyl]phenol?
3-[(E)-hex-1-enyl]phenol has a molecular weight of 176.26 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-hex-1-enyl]phenol is sourced from PubChem (CID 121007177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).