C23H34O — CID 175776848
3-heptadeca-1,3,5-trienylphenol (PubChem CID 175776848) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 3-heptadeca-1,3,5-trienylphenol.
| Compound Name | 3-heptadeca-1,3,5-trienylphenol |
|---|---|
| PubChem CID | 175776848 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 3-heptadeca-1,3,5-trienylphenol |
| SMILES | CCCCCCCCCCCC=CC=CC=Cc1cccc(O)c1 |
| InChI | InChI=1S/C23H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-22-19-17-20-23(24)21-22/h12-21,24H,2-11H2,1H3 |
| InChIKey | CVQNFBVDKFOPGJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|