C21H32O — CID 101292637
3-[(1E,4E)-pentadeca-1,4-dienyl]phenol (PubChem CID 101292637) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is 3-[(1E,4E)-pentadeca-1,4-dienyl]phenol.
| Compound Name | 3-[(1E,4E)-pentadeca-1,4-dienyl]phenol |
|---|---|
| PubChem CID | 101292637 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 3-[(1E,4E)-pentadeca-1,4-dienyl]phenol |
| SMILES | CCCCCCCCCC/C=C/C/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C21H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h11-12,14-19,22H,2-10,13H2,1H3/b12-11+,16-14+ |
| InChIKey | MZXJLRNSIUHWSR-SIDAKMONSA-N |
| XLogP | 6.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|