C21H30O2 — CID 91476848
2-pentadeca-1,3,5-trienylbenzene-1,3-diol (PubChem CID 91476848) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-pentadeca-1,3,5-trienylbenzene-1,3-diol.
| Compound Name | 2-pentadeca-1,3,5-trienylbenzene-1,3-diol |
|---|---|
| PubChem CID | 91476848 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-pentadeca-1,3,5-trienylbenzene-1,3-diol |
| SMILES | CCCCCCCCCC=CC=CC=Cc1c(O)cccc1O |
| InChI | InChI=1S/C21H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-20(22)17-15-18-21(19)23/h10-18,22-23H,2-9H2,1H3 |
| InChIKey | ZVWMNKSPZIALOL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|