C14H18O — CID 54092888
2-octa-1,3-dienylphenol (PubChem CID 54092888) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-octa-1,3-dienylphenol.
| Compound Name | 2-octa-1,3-dienylphenol |
|---|---|
| PubChem CID | 54092888 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-octa-1,3-dienylphenol |
| SMILES | CCCCC=CC=Cc1ccccc1O |
| InChI | InChI=1S/C14H18O/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h5-12,15H,2-4H2,1H3 |
| InChIKey | MVBVVOCVALYDHC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|