C12H14O — CID 89362238
2-[(1Z,3Z)-hexa-1,3-dienyl]phenol (PubChem CID 89362238) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-[(1Z,3Z)-hexa-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z,3Z)-hexa-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 89362238 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-[(1Z,3Z)-hexa-1,3-dienyl]phenol |
| SMILES | CC/C=C\C=C/c1ccccc1O |
| InChI | InChI=1S/C12H14O/c1-2-3-4-5-8-11-9-6-7-10-12(11)13/h3-10,13H,2H2,1H3/b4-3-,8-5- |
| InChIKey | NTLCYZQWDHZWMB-UBNNFMAXSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|