C11H12O — CID 141162259
2-penta-1,3-dienylphenol (PubChem CID 141162259) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-penta-1,3-dienylphenol.
| Compound Name | 2-penta-1,3-dienylphenol |
|---|---|
| PubChem CID | 141162259 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-penta-1,3-dienylphenol |
| SMILES | CC=CC=Cc1ccccc1O |
| InChI | InChI=1S/C11H12O/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2-9,12H,1H3 |
| InChIKey | OAINZFHAOKAJGM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|