About methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol)
methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) (PubChem CID 167541647) has the molecular formula C31H40O3
and a molecular weight of 460.66 g/mol. Its IUPAC name is methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol).
Molecular Properties
| Compound Name | methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) |
| PubChem CID | 167541647 |
| Molecular Formula | C31H40O3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) |
| SMILES | C.C/C=C/c1cccc(C(C)C)c1O.C/C=C/c1ccccc1O.C/C=C/c1ccccc1O |
| InChI | InChI=1S/C12H16O.2C9H10O.CH4/c1-4-6-10-7-5-8-11(9(2)3)12(10)13;2*1-2-5-8-6-3-4-7-9(8)10;/h4-9,13H,1-3H3;2*2-7,10H,1H3;1H4/b6-4+;2*5-2+; |
| InChIKey | BGRYCHARLDUSFM-PRMYWLQESA-N |
| XLogP | 9.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol)?
The IUPAC name of methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) (CID 167541647) is methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol).
What is the SMILES notation for methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol)?
The canonical SMILES for methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) is C.C/C=C/c1cccc(C(C)C)c1O.C/C=C/c1ccccc1O.C/C=C/c1ccccc1O.
What is the InChIKey of methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol)?
The InChIKey is BGRYCHARLDUSFM-PRMYWLQESA-N. The full InChI is InChI=1S/C12H16O.2C9H10O.CH4/c1-4-6-10-7-5-8-11(9(2)3)12(10)13;2*1-2-5-8-6-3-4-7-9(8)10;/h4-9,13H,1-3H3;2*2-7,10H,1H3;1H4/b6-4+;2*5-2+;.
What are the key properties of methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol)?
methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) has a molecular weight of 460.66 g/mol, XLogP of 9.04, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-propan-2-yl-6-[(E)-prop-1-enyl]phenol;bis(2-[(E)-prop-1-enyl]phenol) is sourced from PubChem (CID 167541647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).