C14H16O2 — CID 56652490
3-[(1E,3E,5E)-hepta-1,3,5-trienyl]-2-(hydroxymethyl)phenol (PubChem CID 56652490) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[(1E,3E,5E)-hepta-1,3,5-trienyl]-2-(hydroxymethyl)phenol.
| Compound Name | 3-[(1E,3E,5E)-hepta-1,3,5-trienyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 56652490 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-[(1E,3E,5E)-hepta-1,3,5-trienyl]-2-(hydroxymethyl)phenol |
| SMILES | C/C=C/C=C/C=C/c1cccc(O)c1CO |
| InChI | InChI=1S/C14H16O2/c1-2-3-4-5-6-8-12-9-7-10-14(16)13(12)11-15/h2-10,15-16H,11H2,1H3/b3-2+,5-4+,8-6+ |
| InChIKey | RAPRHPMLRKUIJH-KHSJKHEISA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|