C18H24O3 — CID 171118921
2-hydroxy-6-[(1E,3E)-7-hydroxyundeca-1,3-dienyl]benzaldehyde (PubChem CID 171118921) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-hydroxy-6-[(1E,3E)-7-hydroxyundeca-1,3-dienyl]benzaldehyde.
| Compound Name | 2-hydroxy-6-[(1E,3E)-7-hydroxyundeca-1,3-dienyl]benzaldehyde |
|---|---|
| PubChem CID | 171118921 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-hydroxy-6-[(1E,3E)-7-hydroxyundeca-1,3-dienyl]benzaldehyde |
| SMILES | CCCCC(O)CC/C=C/C=C/c1cccc(O)c1C=O |
| InChI | InChI=1S/C18H24O3/c1-2-3-11-16(20)12-7-5-4-6-9-15-10-8-13-18(21)17(15)14-19/h4-6,8-10,13-14,16,20-21H,2-3,7,11-12H2,1H3/b5-4+,9-6+ |
| InChIKey | FCHLSECGCHCCEV-HSKKLARCSA-N |
| XLogP | 4.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|