C16H20O3 — CID 162816221
2,3-dihydroxy-6-nona-1,3-dienylbenzaldehyde (PubChem CID 162816221) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,3-dihydroxy-6-nona-1,3-dienylbenzaldehyde.
| Compound Name | 2,3-dihydroxy-6-nona-1,3-dienylbenzaldehyde |
|---|---|
| PubChem CID | 162816221 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,3-dihydroxy-6-nona-1,3-dienylbenzaldehyde |
| SMILES | CCCCCC=CC=Cc1ccc(O)c(O)c1C=O |
| InChI | InChI=1S/C16H20O3/c1-2-3-4-5-6-7-8-9-13-10-11-15(18)16(19)14(13)12-17/h6-12,18-19H,2-5H2,1H3 |
| InChIKey | RFEBXOACIADDAU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|