C30H46O3 — CID 160833457
3-(2-pentadeca-1,3,5-trienylphenyl)prop-2-enoic acid;2-propan-2-yloxypropane (PubChem CID 160833457) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 3-(2-pentadeca-1,3,5-trienylphenyl)prop-2-enoic acid;2-propan-2-yloxypropane.
| Compound Name | 3-(2-pentadeca-1,3,5-trienylphenyl)prop-2-enoic acid;2-propan-2-yloxypropane |
|---|---|
| PubChem CID | 160833457 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 3-(2-pentadeca-1,3,5-trienylphenyl)prop-2-enoic acid;2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C.CCCCCCCCCC=CC=CC=Cc1ccccc1C=CC(=O)O |
| InChI | InChI=1S/C24H32O2.C6H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-22-18-15-16-19-23(22)20-21-24(25)26;1-5(2)7-6(3)4/h10-21H,2-9H2,1H3,(H,25,26);5-6H,1-4H3 |
| InChIKey | SHCKECUVSSLYJH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|