C23H28O3 — CID 57121444
5-[2-[3-(6-hydroxy-7-methyloct-1-enyl)phenyl]ethenyl]benzene-1,3-diol (PubChem CID 57121444) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 5-[2-[3-(6-hydroxy-7-methyloct-1-enyl)phenyl]ethenyl]benzene-1,3-diol.
| Compound Name | 5-[2-[3-(6-hydroxy-7-methyloct-1-enyl)phenyl]ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 57121444 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 5-[2-[3-(6-hydroxy-7-methyloct-1-enyl)phenyl]ethenyl]benzene-1,3-diol |
| SMILES | CC(C)C(O)CCCC=Cc1cccc(C=Cc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C23H28O3/c1-17(2)23(26)10-5-3-4-7-18-8-6-9-19(13-18)11-12-20-14-21(24)16-22(25)15-20/h4,6-9,11-17,23-26H,3,5,10H2,1-2H3 |
| InChIKey | PSDGCTCPUYVNCY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|