C24H32O3 — CID 57167140
7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethenyl]phenyl]-2-methylheptan-2-ol (PubChem CID 57167140) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethenyl]phenyl]-2-methylheptan-2-ol.
| Compound Name | 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethenyl]phenyl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 57167140 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethenyl]phenyl]-2-methylheptan-2-ol |
| SMILES | CC(C)(O)CCCCCc1cccc(C=Cc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C24H32O3/c1-24(2,27)14-5-3-4-7-19-8-6-9-20(15-19)10-11-21-12-13-22(17-25)23(16-21)18-26/h6,8-13,15-16,25-27H,3-5,7,14,17-18H2,1-2H3 |
| InChIKey | UPMONUHDKZCFJB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|