C19H20F3NO — CID 174640342
[3-[2-[4-(4,4,4-trifluorobutylamino)phenyl]ethenyl]phenyl]methanol (PubChem CID 174640342) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is [3-[2-[4-(4,4,4-trifluorobutylamino)phenyl]ethenyl]phenyl]methanol.
| Compound Name | [3-[2-[4-(4,4,4-trifluorobutylamino)phenyl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 174640342 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [3-[2-[4-(4,4,4-trifluorobutylamino)phenyl]ethenyl]phenyl]methanol |
| SMILES | OCc1cccc(C=Cc2ccc(NCCCC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3NO/c20-19(21,22)11-2-12-23-18-9-7-15(8-10-18)5-6-16-3-1-4-17(13-16)14-24/h1,3-10,13,23-24H,2,11-12,14H2 |
| InChIKey | XBNQGASZMBTAHO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|