C13H18Br2 — CID 83142669
1-bromo-3-[2-(bromomethyl)-3,3-dimethylbutyl]benzene (PubChem CID 83142669) has the molecular formula C13H18Br2 and a molecular weight of 334.10 g/mol. Its IUPAC name is 1-bromo-3-[2-(bromomethyl)-3,3-dimethylbutyl]benzene.
| Compound Name | 1-bromo-3-[2-(bromomethyl)-3,3-dimethylbutyl]benzene |
|---|---|
| PubChem CID | 83142669 |
| Molecular Formula | C13H18Br2 |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 1-bromo-3-[2-(bromomethyl)-3,3-dimethylbutyl]benzene |
| SMILES | CC(C)(C)C(CBr)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H18Br2/c1-13(2,3)11(9-14)7-10-5-4-6-12(15)8-10/h4-6,8,11H,7,9H2,1-3H3 |
| InChIKey | NUBDVEZGZXPQOI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|