C12H19BrO2 — CID 143308934
1-bromo-3-(2,2-dimethoxyethyl)benzene;ethane (PubChem CID 143308934) has the molecular formula C12H19BrO2 and a molecular weight of 275.19 g/mol. Its IUPAC name is 1-bromo-3-(2,2-dimethoxyethyl)benzene;ethane.
| Compound Name | 1-bromo-3-(2,2-dimethoxyethyl)benzene;ethane |
|---|---|
| PubChem CID | 143308934 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-bromo-3-(2,2-dimethoxyethyl)benzene;ethane |
| SMILES | CC.COC(Cc1cccc(Br)c1)OC |
| InChI | InChI=1S/C10H13BrO2.C2H6/c1-12-10(13-2)7-8-4-3-5-9(11)6-8;1-2/h3-6,10H,7H2,1-2H3;1-2H3 |
| InChIKey | CYQWQQFERCIFQB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|