C13H19BrO2 — CID 22946784
1-bromo-3-(5,5-dimethoxypentyl)benzene (PubChem CID 22946784) has the molecular formula C13H19BrO2 and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-bromo-3-(5,5-dimethoxypentyl)benzene.
| Compound Name | 1-bromo-3-(5,5-dimethoxypentyl)benzene |
|---|---|
| PubChem CID | 22946784 |
| Molecular Formula | C13H19BrO2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-bromo-3-(5,5-dimethoxypentyl)benzene |
| SMILES | COC(CCCCc1cccc(Br)c1)OC |
| InChI | InChI=1S/C13H19BrO2/c1-15-13(16-2)9-4-3-6-11-7-5-8-12(14)10-11/h5,7-8,10,13H,3-4,6,9H2,1-2H3 |
| InChIKey | ZGLDYTSCCYEVBW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|