C13H20BrN — CID 64504358
1-(3-bromophenyl)heptan-4-amine (PubChem CID 64504358) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-(3-bromophenyl)heptan-4-amine.
| Compound Name | 1-(3-bromophenyl)heptan-4-amine |
|---|---|
| PubChem CID | 64504358 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(3-bromophenyl)heptan-4-amine |
| SMILES | CCCC(N)CCCc1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrN/c1-2-5-13(15)9-4-7-11-6-3-8-12(14)10-11/h3,6,8,10,13H,2,4-5,7,9,15H2,1H3 |
| InChIKey | PHYWKVVVWKUAHR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |