About 4-(4-aminoheptyl)aniline
4-(4-aminoheptyl)aniline (PubChem CID 83928416) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-(4-aminoheptyl)aniline.
Molecular Properties
| Compound Name | 4-(4-aminoheptyl)aniline |
| PubChem CID | 83928416 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-(4-aminoheptyl)aniline |
| SMILES | CCCC(N)CCCc1ccc(N)cc1 |
| InChI | InChI=1S/C13H22N2/c1-2-4-12(14)6-3-5-11-7-9-13(15)10-8-11/h7-10,12H,2-6,14-15H2,1H3 |
| InChIKey | NLCNIMGFOLHFRI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminoheptyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminoheptyl)aniline?
The IUPAC name of 4-(4-aminoheptyl)aniline (CID 83928416) is 4-(4-aminoheptyl)aniline.
What is the SMILES notation for 4-(4-aminoheptyl)aniline?
The canonical SMILES for 4-(4-aminoheptyl)aniline is CCCC(N)CCCc1ccc(N)cc1.
What is the InChIKey of 4-(4-aminoheptyl)aniline?
The InChIKey is NLCNIMGFOLHFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-2-4-12(14)6-3-5-11-7-9-13(15)10-8-11/h7-10,12H,2-6,14-15H2,1H3.
What are the key properties of 4-(4-aminoheptyl)aniline?
4-(4-aminoheptyl)aniline has a molecular weight of 206.33 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminoheptyl)aniline is sourced from PubChem (CID 83928416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).