About 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane
8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane (PubChem CID 142803034) has the molecular formula C23H45NO2
and a molecular weight of 367.62 g/mol. Its IUPAC name is 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane.
Molecular Properties
| Compound Name | 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane |
| PubChem CID | 142803034 |
| Molecular Formula | C23H45NO2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.35 |
| IUPAC Name | 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane |
| SMILES | CCCCCCc1ccc(CCCCC(N)CCC)cc1.CO.COC |
| InChI | InChI=1S/C20H35N.C2H6O.CH4O/c1-3-5-6-7-11-18-14-16-19(17-15-18)12-8-9-13-20(21)10-4-2;1-3-2;1-2/h14-17,20H,3-13,21H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | WMGWKBLZMFJNKC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane?
The IUPAC name of 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane (CID 142803034) is 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane.
What is the SMILES notation for 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane?
The canonical SMILES for 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane is CCCCCCc1ccc(CCCCC(N)CCC)cc1.CO.COC.
What is the InChIKey of 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane?
The InChIKey is WMGWKBLZMFJNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N.C2H6O.CH4O/c1-3-5-6-7-11-18-14-16-19(17-15-18)12-8-9-13-20(21)10-4-2;1-3-2;1-2/h14-17,20H,3-13,21H2,1-2H3;1-2H3;2H,1H3.
What are the key properties of 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane?
8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane has a molecular weight of 367.62 g/mol, XLogP of 5.52, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-hexylphenyl)octan-4-amine;methanol;methoxymethane is sourced from PubChem (CID 142803034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).