C19H34NO3P — CID 10150154
[3-amino-7-(4-hexylphenyl)heptyl]phosphonic acid (PubChem CID 10150154) has the molecular formula C19H34NO3P and a molecular weight of 355.46 g/mol. Its IUPAC name is [3-amino-7-(4-hexylphenyl)heptyl]phosphonic acid.
| Compound Name | [3-amino-7-(4-hexylphenyl)heptyl]phosphonic acid |
|---|---|
| PubChem CID | 10150154 |
| Molecular Formula | C19H34NO3P |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [3-amino-7-(4-hexylphenyl)heptyl]phosphonic acid |
| SMILES | CCCCCCc1ccc(CCCCC(N)CCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H34NO3P/c1-2-3-4-5-8-17-11-13-18(14-12-17)9-6-7-10-19(20)15-16-24(21,22)23/h11-14,19H,2-10,15-16,20H2,1H3,(H2,21,22,23) |
| InChIKey | RBIYJDULZRTDDF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|