C18H31N2O4P — CID 11545181
[(3R)-3-amino-4-(3-octylanilino)-4-oxobutyl]phosphonic acid (PubChem CID 11545181) has the molecular formula C18H31N2O4P and a molecular weight of 370.43 g/mol. Its IUPAC name is [(3R)-3-amino-4-(3-octylanilino)-4-oxobutyl]phosphonic acid.
| Compound Name | [(3R)-3-amino-4-(3-octylanilino)-4-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 11545181 |
| Molecular Formula | C18H31N2O4P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(3R)-3-amino-4-(3-octylanilino)-4-oxobutyl]phosphonic acid |
| SMILES | CCCCCCCCc1cccc(NC(=O)[C@H](N)CCP(=O)(O)O)c1 |
| InChI | InChI=1S/C18H31N2O4P/c1-2-3-4-5-6-7-9-15-10-8-11-16(14-15)20-18(21)17(19)12-13-25(22,23)24/h8,10-11,14,17H,2-7,9,12-13,19H2,1H3,(H,20,21)(H2,22,23,24)/t17-/m1/s1 |
| InChIKey | FMLHSOGKNHADEE-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|