C20H34NO3P — CID 158470886
[3-amino-5-(3-octylphenyl)-4-oxopentyl]-methylphosphinic acid (PubChem CID 158470886) has the molecular formula C20H34NO3P and a molecular weight of 367.47 g/mol. Its IUPAC name is [3-amino-5-(3-octylphenyl)-4-oxopentyl]-methylphosphinic acid.
| Compound Name | [3-amino-5-(3-octylphenyl)-4-oxopentyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 158470886 |
| Molecular Formula | C20H34NO3P |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [3-amino-5-(3-octylphenyl)-4-oxopentyl]-methylphosphinic acid |
| SMILES | CCCCCCCCc1cccc(CC(=O)C(N)CCP(C)(=O)O)c1 |
| InChI | InChI=1S/C20H34NO3P/c1-3-4-5-6-7-8-10-17-11-9-12-18(15-17)16-20(22)19(21)13-14-25(2,23)24/h9,11-12,15,19H,3-8,10,13-14,16,21H2,1-2H3,(H,23,24) |
| InChIKey | IEKOEXBTOWAXJZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|