C16H27N2O4P — CID 88542167
[(3R)-3-amino-4-oxobutyl]-(3-hexylanilino)oxyphosphinic acid (PubChem CID 88542167) has the molecular formula C16H27N2O4P and a molecular weight of 342.38 g/mol. Its IUPAC name is [(3R)-3-amino-4-oxobutyl]-(3-hexylanilino)oxyphosphinic acid.
| Compound Name | [(3R)-3-amino-4-oxobutyl]-(3-hexylanilino)oxyphosphinic acid |
|---|---|
| PubChem CID | 88542167 |
| Molecular Formula | C16H27N2O4P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(3R)-3-amino-4-oxobutyl]-(3-hexylanilino)oxyphosphinic acid |
| SMILES | CCCCCCc1cccc(NOP(=O)(O)CC[C@@H](N)C=O)c1 |
| InChI | InChI=1S/C16H27N2O4P/c1-2-3-4-5-7-14-8-6-9-16(12-14)18-22-23(20,21)11-10-15(17)13-19/h6,8-9,12-13,15,18H,2-5,7,10-11,17H2,1H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | WLOQPUCSESYGRT-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|