C18H31O5P — CID 134605624
2-[(3-nonylphenyl)methoxy]ethyl dihydrogen phosphate (PubChem CID 134605624) has the molecular formula C18H31O5P and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[(3-nonylphenyl)methoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[(3-nonylphenyl)methoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 134605624 |
| Molecular Formula | C18H31O5P |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[(3-nonylphenyl)methoxy]ethyl dihydrogen phosphate |
| SMILES | CCCCCCCCCc1cccc(COCCOP(=O)(O)O)c1 |
| InChI | InChI=1S/C18H31O5P/c1-2-3-4-5-6-7-8-10-17-11-9-12-18(15-17)16-22-13-14-23-24(19,20)21/h9,11-12,15H,2-8,10,13-14,16H2,1H3,(H2,19,20,21) |
| InChIKey | LXLOEKVXHNVJLM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|