C20H34O4 — CID 142762210
1,3-bis(3-butylperoxypropyl)benzene (PubChem CID 142762210) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1,3-bis(3-butylperoxypropyl)benzene.
| Compound Name | 1,3-bis(3-butylperoxypropyl)benzene |
|---|---|
| PubChem CID | 142762210 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1,3-bis(3-butylperoxypropyl)benzene |
| SMILES | CCCCOOCCCc1cccc(CCCOOCCCC)c1 |
| InChI | InChI=1S/C20H34O4/c1-3-5-14-21-23-16-8-12-19-10-7-11-20(18-19)13-9-17-24-22-15-6-4-2/h7,10-11,18H,3-6,8-9,12-17H2,1-2H3 |
| InChIKey | ZQIFJWSAGWHXGC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|