C16H26NO4P — CID 130432103
[4-(3-hexylanilino)-4-oxobutyl]phosphonic acid (PubChem CID 130432103) has the molecular formula C16H26NO4P and a molecular weight of 327.36 g/mol. Its IUPAC name is [4-(3-hexylanilino)-4-oxobutyl]phosphonic acid.
| Compound Name | [4-(3-hexylanilino)-4-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 130432103 |
| Molecular Formula | C16H26NO4P |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [4-(3-hexylanilino)-4-oxobutyl]phosphonic acid |
| SMILES | CCCCCCc1cccc(NC(=O)CCCP(=O)(O)O)c1 |
| InChI | InChI=1S/C16H26NO4P/c1-2-3-4-5-8-14-9-6-10-15(13-14)17-16(18)11-7-12-22(19,20)21/h6,9-10,13H,2-5,7-8,11-12H2,1H3,(H,17,18)(H2,19,20,21) |
| InChIKey | FCNBHVQOZBQNCE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|