C16H30N2O6P2 — CID 135220945
[[(4-decyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 135220945) has the molecular formula C16H30N2O6P2 and a molecular weight of 408.37 g/mol. Its IUPAC name is [[(4-decyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[(4-decyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 135220945 |
| Molecular Formula | C16H30N2O6P2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [[(4-decyl-2-pyridinyl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | CCCCCCCCCCc1ccnc(NC(P(=O)(O)O)P(=O)(O)O)c1 |
| InChI | InChI=1S/C16H30N2O6P2/c1-2-3-4-5-6-7-8-9-10-14-11-12-17-15(13-14)18-16(25(19,20)21)26(22,23)24/h11-13,16H,2-10H2,1H3,(H,17,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | PKBAHUCTRMCYEH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|