C14H25NO6P2 — CID 5277463
[(4-heptylanilino)-phosphonomethyl]phosphonic acid (PubChem CID 5277463) has the molecular formula C14H25NO6P2 and a molecular weight of 365.30 g/mol. Its IUPAC name is [(4-heptylanilino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(4-heptylanilino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 5277463 |
| Molecular Formula | C14H25NO6P2 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [(4-heptylanilino)-phosphonomethyl]phosphonic acid |
| SMILES | CCCCCCCc1ccc(NC(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C14H25NO6P2/c1-2-3-4-5-6-7-12-8-10-13(11-9-12)15-14(22(16,17)18)23(19,20)21/h8-11,14-15H,2-7H2,1H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | IGHWTRWWSFAETJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|