C15H22N2O12P4 — CID 118707094
[[4-[[4-(diphosphonomethylamino)phenyl]methyl]anilino]-phosphonomethyl]phosphonic acid (PubChem CID 118707094) has the molecular formula C15H22N2O12P4 and a molecular weight of 546.24 g/mol. Its IUPAC name is [[4-[[4-(diphosphonomethylamino)phenyl]methyl]anilino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[4-[[4-(diphosphonomethylamino)phenyl]methyl]anilino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 118707094 |
| Molecular Formula | C15H22N2O12P4 |
| Molecular Weight | 546.24 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | [[4-[[4-(diphosphonomethylamino)phenyl]methyl]anilino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1ccc(Cc2ccc(NC(P(=O)(O)O)P(=O)(O)O)cc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C15H22N2O12P4/c18-30(19,20)14(31(21,22)23)16-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)17-15(32(24,25)26)33(27,28)29/h1-8,14-17H,9H2,(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29) |
| InChIKey | ZHHTYWAXFJQRRM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 254.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|