C17H22NO3P — CID 42948670
[(2,4-dimethylphenyl)-(4-ethylanilino)methyl]phosphonic acid (PubChem CID 42948670) has the molecular formula C17H22NO3P and a molecular weight of 319.34 g/mol. Its IUPAC name is [(2,4-dimethylphenyl)-(4-ethylanilino)methyl]phosphonic acid.
| Compound Name | [(2,4-dimethylphenyl)-(4-ethylanilino)methyl]phosphonic acid |
|---|---|
| PubChem CID | 42948670 |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | [(2,4-dimethylphenyl)-(4-ethylanilino)methyl]phosphonic acid |
| SMILES | CCc1ccc(NC(c2ccc(C)cc2C)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H22NO3P/c1-4-14-6-8-15(9-7-14)18-17(22(19,20)21)16-10-5-12(2)11-13(16)3/h5-11,17-18H,4H2,1-3H3,(H2,19,20,21) |
| InChIKey | ZRNHPTWDBAZALF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|