C17H21O4P — CID 69050397
bis(2,4-dimethylphenyl)methyl dihydrogen phosphate (PubChem CID 69050397) has the molecular formula C17H21O4P and a molecular weight of 320.33 g/mol. Its IUPAC name is bis(2,4-dimethylphenyl)methyl dihydrogen phosphate.
| Compound Name | bis(2,4-dimethylphenyl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 69050397 |
| Molecular Formula | C17H21O4P |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | bis(2,4-dimethylphenyl)methyl dihydrogen phosphate |
| SMILES | Cc1ccc(C(OP(=O)(O)O)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C17H21O4P/c1-11-5-7-15(13(3)9-11)17(21-22(18,19)20)16-8-6-12(2)10-14(16)4/h5-10,17H,1-4H3,(H2,18,19,20) |
| InChIKey | DHCDXXRDWVKSIP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|