C10H15NO — CID 130067534
N-[(1S)-1-(2,4-dimethylphenyl)ethyl]hydroxylamine (PubChem CID 130067534) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dimethylphenyl)ethyl]hydroxylamine.
| Compound Name | N-[(1S)-1-(2,4-dimethylphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 130067534 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[(1S)-1-(2,4-dimethylphenyl)ethyl]hydroxylamine |
| SMILES | Cc1ccc([C@H](C)NO)c(C)c1 |
| InChI | InChI=1S/C10H15NO/c1-7-4-5-10(8(2)6-7)9(3)11-12/h4-6,9,11-12H,1-3H3/t9-/m0/s1 |
| InChIKey | BJRBIRIYAFRJBX-VIFPVBQESA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|