C13H21NO — CID 43206550
3-[1-(2,4-dimethylphenyl)ethylamino]propan-1-ol (PubChem CID 43206550) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-[1-(2,4-dimethylphenyl)ethylamino]propan-1-ol.
| Compound Name | 3-[1-(2,4-dimethylphenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 43206550 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-[1-(2,4-dimethylphenyl)ethylamino]propan-1-ol |
| SMILES | Cc1ccc(C(C)NCCCO)c(C)c1 |
| InChI | InChI=1S/C13H21NO/c1-10-5-6-13(11(2)9-10)12(3)14-7-4-8-15/h5-6,9,12,14-15H,4,7-8H2,1-3H3 |
| InChIKey | VPSUADMVEWKYEA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|