C14H21NO2 — CID 43139725
methyl 3-[1-(2,4-dimethylphenyl)ethylamino]propanoate (PubChem CID 43139725) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is methyl 3-[1-(2,4-dimethylphenyl)ethylamino]propanoate.
| Compound Name | methyl 3-[1-(2,4-dimethylphenyl)ethylamino]propanoate |
|---|---|
| PubChem CID | 43139725 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | methyl 3-[1-(2,4-dimethylphenyl)ethylamino]propanoate |
| SMILES | COC(=O)CCNC(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-10-5-6-13(11(2)9-10)12(3)15-8-7-14(16)17-4/h5-6,9,12,15H,7-8H2,1-4H3 |
| InChIKey | IGWJXGYBHWUUEV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |