C15H27NO4P+ — CID 18978191
trimethyl-[2-(5-methyl-2-propan-2-ylphenyl)-2-phosphonooxyethyl]azanium (PubChem CID 18978191) has the molecular formula C15H27NO4P+ and a molecular weight of 316.36 g/mol. Its IUPAC name is trimethyl-[2-(5-methyl-2-propan-2-ylphenyl)-2-phosphonooxyethyl]azanium.
| Compound Name | trimethyl-[2-(5-methyl-2-propan-2-ylphenyl)-2-phosphonooxyethyl]azanium |
|---|---|
| PubChem CID | 18978191 |
| Molecular Formula | C15H27NO4P+ |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | trimethyl-[2-(5-methyl-2-propan-2-ylphenyl)-2-phosphonooxyethyl]azanium |
| SMILES | Cc1ccc(C(C)C)c(C(C[N+](C)(C)C)OP(=O)(O)O)c1 |
| InChI | InChI=1S/C15H26NO4P/c1-11(2)13-8-7-12(3)9-14(13)15(10-16(4,5)6)20-21(17,18)19/h7-9,11,15H,10H2,1-6H3,(H-,17,18,19)/p+1 |
| InChIKey | SSUYJQIJXDIOCW-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|