C13H15NO6P2 — CID 5277466
[(3-phenylanilino)-phosphonomethyl]phosphonic acid (PubChem CID 5277466) has the molecular formula C13H15NO6P2 and a molecular weight of 343.21 g/mol. Its IUPAC name is [(3-phenylanilino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(3-phenylanilino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 5277466 |
| Molecular Formula | C13H15NO6P2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [(3-phenylanilino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cccc(-c2ccccc2)c1)P(=O)(O)O |
| InChI | InChI=1S/C13H15NO6P2/c15-21(16,17)13(22(18,19)20)14-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,13-14H,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | IXFMBXNLOHKCPT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|