C12H18N2O12P4 — CID 71528946
[[[5-(diphosphonomethylamino)naphthalen-1-yl]amino]-phosphonomethyl]phosphonic acid (PubChem CID 71528946) has the molecular formula C12H18N2O12P4 and a molecular weight of 506.17 g/mol. Its IUPAC name is [[[5-(diphosphonomethylamino)naphthalen-1-yl]amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[[5-(diphosphonomethylamino)naphthalen-1-yl]amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 71528946 |
| Molecular Formula | C12H18N2O12P4 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | [[[5-(diphosphonomethylamino)naphthalen-1-yl]amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cccc2c(NC(P(=O)(O)O)P(=O)(O)O)cccc12)P(=O)(O)O |
| InChI | InChI=1S/C12H18N2O12P4/c15-27(16,17)11(28(18,19)20)13-9-5-1-3-7-8(9)4-2-6-10(7)14-12(29(21,22)23)30(24,25)26/h1-6,11-14H,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26) |
| InChIKey | CAMMZUPTZBEGGL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 254.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|