C13H13N3O6P2S — CID 71583207
[[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 71583207) has the molecular formula C13H13N3O6P2S and a molecular weight of 401.28 g/mol. Its IUPAC name is [[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 71583207 |
| Molecular Formula | C13H13N3O6P2S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | [[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1ncnc2sc(-c3ccccc3)cc12)P(=O)(O)O |
| InChI | InChI=1S/C13H13N3O6P2S/c17-23(18,19)13(24(20,21)22)16-11-9-6-10(8-4-2-1-3-5-8)25-12(9)15-7-14-11/h1-7,13H,(H,14,15,16)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | RKCFLTMAEZJQBB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|