C19H23N3S — CID 7831254
N-[(2R)-5-methylhexan-2-yl]-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 7831254) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is N-[(2R)-5-methylhexan-2-yl]-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2R)-5-methylhexan-2-yl]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 7831254 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[(2R)-5-methylhexan-2-yl]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)CC[C@@H](C)Nc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H23N3S/c1-13(2)9-10-14(3)22-18-16-11-17(15-7-5-4-6-8-15)23-19(16)21-12-20-18/h4-8,11-14H,9-10H2,1-3H3,(H,20,21,22)/t14-/m1/s1 |
| InChIKey | KOVJVRFWWRGFJS-CQSZACIVSA-N |
| XLogP | 5.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |