About dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate
dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate (PubChem CID 1039308) has the molecular formula C22H17N3O4S
and a molecular weight of 419.46 g/mol. Its IUPAC name is dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate |
| PubChem CID | 1039308 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc3sc(-c4ccccc4)cc23)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H17N3O4S/c1-28-21(26)14-8-15(22(27)29-2)10-16(9-14)25-19-17-11-18(13-6-4-3-5-7-13)30-20(17)24-12-23-19/h3-12H,1-2H3,(H,23,24,25) |
| InChIKey | CWMHAUQCHQVILM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate?
The IUPAC name of dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate (CID 1039308) is dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate is COC(=O)c1cc(Nc2ncnc3sc(-c4ccccc4)cc23)cc(C(=O)OC)c1.
What is the InChIKey of dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate?
The InChIKey is CWMHAUQCHQVILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O4S/c1-28-21(26)14-8-15(22(27)29-2)10-16(9-14)25-19-17-11-18(13-6-4-3-5-7-13)30-20(17)24-12-23-19/h3-12H,1-2H3,(H,23,24,25).
What are the key properties of dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate?
dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate has a molecular weight of 419.46 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzene-1,3-dicarboxylate is sourced from PubChem (CID 1039308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).