C21H19N3O2S2 — CID 133398054
N-[4-(2-methylsulfonylethyl)phenyl]-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 133398054) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-[4-(2-methylsulfonylethyl)phenyl]-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[4-(2-methylsulfonylethyl)phenyl]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133398054 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[4-(2-methylsulfonylethyl)phenyl]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCc1ccc(Nc2ncnc3sc(-c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-28(25,26)12-11-15-7-9-17(10-8-15)24-20-18-13-19(16-5-3-2-4-6-16)27-21(18)23-14-22-20/h2-10,13-14H,11-12H2,1H3,(H,22,23,24) |
| InChIKey | JKFTWTMKJBNBCJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |