C15H14ClN3S — CID 65027620
N-[4-(2-chloroethyl)phenyl]-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 65027620) has the molecular formula C15H14ClN3S and a molecular weight of 303.82 g/mol. Its IUPAC name is N-[4-(2-chloroethyl)phenyl]-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[4-(2-chloroethyl)phenyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 65027620 |
| Molecular Formula | C15H14ClN3S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[4-(2-chloroethyl)phenyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(Nc3ccc(CCCl)cc3)ncnc2s1 |
| InChI | InChI=1S/C15H14ClN3S/c1-10-8-13-14(17-9-18-15(13)20-10)19-12-4-2-11(3-5-12)6-7-16/h2-5,8-9H,6-7H2,1H3,(H,17,18,19) |
| InChIKey | OMDLRBZQEUOYKE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|