About methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate
methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate (PubChem CID 725204) has the molecular formula C16H14N2O2S2
and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate |
| PubChem CID | 725204 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate |
| SMILES | COC(=O)[C@H](C)Sc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C16H14N2O2S2/c1-10(16(19)20-2)21-14-12-8-13(11-6-4-3-5-7-11)22-15(12)18-9-17-14/h3-10H,1-2H3/t10-/m0/s1 |
| InChIKey | WUGPPVYKUIZTDF-JTQLQIEISA-N |
| XLogP | 4.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate?
The IUPAC name of methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate (CID 725204) is methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate.
What is the SMILES notation for methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate?
The canonical SMILES for methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate is COC(=O)[C@H](C)Sc1ncnc2sc(-c3ccccc3)cc12.
What is the InChIKey of methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate?
The InChIKey is WUGPPVYKUIZTDF-JTQLQIEISA-N. The full InChI is InChI=1S/C16H14N2O2S2/c1-10(16(19)20-2)21-14-12-8-13(11-6-4-3-5-7-11)22-15(12)18-9-17-14/h3-10H,1-2H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate?
methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate has a molecular weight of 330.43 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanoate is sourced from PubChem (CID 725204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).