C15H13N3OS2 — CID 7558288
(2R)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide (PubChem CID 7558288) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | (2R)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7558288 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (2R)-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1ncnc2sc(-c3ccccc3)cc12)C(N)=O |
| InChI | InChI=1S/C15H13N3OS2/c1-9(13(16)19)20-14-11-7-12(10-5-3-2-4-6-10)21-15(11)18-8-17-14/h2-9H,1H3,(H2,16,19)/t9-/m1/s1 |
| InChIKey | QUYQZOCMCIVIDA-SECBINFHSA-N |
| XLogP | 3.32 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |