C20H15N3OS2 — CID 18137836
2-phenyl-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 18137836) has the molecular formula C20H15N3OS2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-phenyl-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | 2-phenyl-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 18137836 |
| Molecular Formula | C20H15N3OS2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-phenyl-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | NC(=O)C(Sc1ncnc2sc(-c3ccccc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H15N3OS2/c21-18(24)17(14-9-5-2-6-10-14)26-20-15-11-16(13-7-3-1-4-8-13)25-19(15)22-12-23-20/h1-12,17H,(H2,21,24) |
| InChIKey | YRNSOLUZUPKSCU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |