C14H11N3S3 — CID 39158958
2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanethioamide (PubChem CID 39158958) has the molecular formula C14H11N3S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is 2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanethioamide.
| Compound Name | 2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanethioamide |
|---|---|
| PubChem CID | 39158958 |
| Molecular Formula | C14H11N3S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanethioamide |
| SMILES | NC(=S)CSc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C14H11N3S3/c15-12(18)7-19-13-10-6-11(9-4-2-1-3-5-9)20-14(10)17-8-16-13/h1-6,8H,7H2,(H2,15,18) |
| InChIKey | MIKFERCFZCLQJS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|